C24H28N4O5S — CID 42970270
[2-(4-cyanoanilino)-2-oxoethyl] 5-(diethylsulfamoyl)-2-pyrrolidin-1-ylbenzoate (PubChem CID 42970270) has the molecular formula C24H28N4O5S and a molecular weight of 484.58 g/mol. Its IUPAC name is [2-(4-cyanoanilino)-2-oxoethyl] 5-(diethylsulfamoyl)-2-pyrrolidin-1-ylbenzoate.
| Compound Name | [2-(4-cyanoanilino)-2-oxoethyl] 5-(diethylsulfamoyl)-2-pyrrolidin-1-ylbenzoate |
|---|---|
| PubChem CID | 42970270 |
| Molecular Formula | C24H28N4O5S |
| Molecular Weight | 484.58 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | [2-(4-cyanoanilino)-2-oxoethyl] 5-(diethylsulfamoyl)-2-pyrrolidin-1-ylbenzoate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(N2CCCC2)c(C(=O)OCC(=O)Nc2ccc(C#N)cc2)c1 |
| InChI | InChI=1S/C24H28N4O5S/c1-3-28(4-2)34(31,32)20-11-12-22(27-13-5-6-14-27)21(15-20)24(30)33-17-23(29)26-19-9-7-18(16-25)8-10-19/h7-12,15H,3-6,13-14,17H2,1-2H3,(H,26,29) |
| InChIKey | MTNHCKOHENFALJ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 119.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.58 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |