C21H26Cl2N4O3S — CID 55463873
N-(4-amino-3,5-dichlorophenyl)-5-(diethylsulfamoyl)-2-pyrrolidin-1-ylbenzamide (PubChem CID 55463873) has the molecular formula C21H26Cl2N4O3S and a molecular weight of 485.44 g/mol. Its IUPAC name is N-(4-amino-3,5-dichlorophenyl)-5-(diethylsulfamoyl)-2-pyrrolidin-1-ylbenzamide.
| Compound Name | N-(4-amino-3,5-dichlorophenyl)-5-(diethylsulfamoyl)-2-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 55463873 |
| Molecular Formula | C21H26Cl2N4O3S |
| Molecular Weight | 485.44 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | N-(4-amino-3,5-dichlorophenyl)-5-(diethylsulfamoyl)-2-pyrrolidin-1-ylbenzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(N2CCCC2)c(C(=O)Nc2cc(Cl)c(N)c(Cl)c2)c1 |
| InChI | InChI=1S/C21H26Cl2N4O3S/c1-3-27(4-2)31(29,30)15-7-8-19(26-9-5-6-10-26)16(13-15)21(28)25-14-11-17(22)20(24)18(23)12-14/h7-8,11-13H,3-6,9-10,24H2,1-2H3,(H,25,28) |
| InChIKey | WKMQOENVCHLIFL-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.44 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|