C24H28N4O3S2 — CID 55990464
5-(diethylsulfamoyl)-2-pyrrolidin-1-yl-N-[3-(1,3-thiazol-2-yl)phenyl]benzamide (PubChem CID 55990464) has the molecular formula C24H28N4O3S2 and a molecular weight of 484.65 g/mol. Its IUPAC name is 5-(diethylsulfamoyl)-2-pyrrolidin-1-yl-N-[3-(1,3-thiazol-2-yl)phenyl]benzamide.
| Compound Name | 5-(diethylsulfamoyl)-2-pyrrolidin-1-yl-N-[3-(1,3-thiazol-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 55990464 |
| Molecular Formula | C24H28N4O3S2 |
| Molecular Weight | 484.65 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | 5-(diethylsulfamoyl)-2-pyrrolidin-1-yl-N-[3-(1,3-thiazol-2-yl)phenyl]benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(N2CCCC2)c(C(=O)Nc2cccc(-c3nccs3)c2)c1 |
| InChI | InChI=1S/C24H28N4O3S2/c1-3-28(4-2)33(30,31)20-10-11-22(27-13-5-6-14-27)21(17-20)23(29)26-19-9-7-8-18(16-19)24-25-12-15-32-24/h7-12,15-17H,3-6,13-14H2,1-2H3,(H,26,29) |
| InChIKey | BCJFQOKAFMGLPF-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.65 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |