C26H36N4O3S — CID 55673941
5-(dimethylsulfamoyl)-2-piperidin-1-yl-N-[3-(piperidin-1-ylmethyl)phenyl]benzamide (PubChem CID 55673941) has the molecular formula C26H36N4O3S and a molecular weight of 484.67 g/mol. Its IUPAC name is 5-(dimethylsulfamoyl)-2-piperidin-1-yl-N-[3-(piperidin-1-ylmethyl)phenyl]benzamide.
| Compound Name | 5-(dimethylsulfamoyl)-2-piperidin-1-yl-N-[3-(piperidin-1-ylmethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 55673941 |
| Molecular Formula | C26H36N4O3S |
| Molecular Weight | 484.67 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | 5-(dimethylsulfamoyl)-2-piperidin-1-yl-N-[3-(piperidin-1-ylmethyl)phenyl]benzamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(N2CCCCC2)c(C(=O)Nc2cccc(CN3CCCCC3)c2)c1 |
| InChI | InChI=1S/C26H36N4O3S/c1-28(2)34(32,33)23-12-13-25(30-16-7-4-8-17-30)24(19-23)26(31)27-22-11-9-10-21(18-22)20-29-14-5-3-6-15-29/h9-13,18-19H,3-8,14-17,20H2,1-2H3,(H,27,31) |
| InChIKey | KFHPHZYTUYNTGE-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.67 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |