C21H28N4O4S — CID 55812100
5-(dimethylsulfamoyl)-N-(1-ethyl-6-oxo-3-pyridinyl)-2-piperidin-1-ylbenzamide (PubChem CID 55812100) has the molecular formula C21H28N4O4S and a molecular weight of 432.55 g/mol. Its IUPAC name is 5-(dimethylsulfamoyl)-N-(1-ethyl-6-oxo-3-pyridinyl)-2-piperidin-1-ylbenzamide.
| Compound Name | 5-(dimethylsulfamoyl)-N-(1-ethyl-6-oxo-3-pyridinyl)-2-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 55812100 |
| Molecular Formula | C21H28N4O4S |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 5-(dimethylsulfamoyl)-N-(1-ethyl-6-oxo-3-pyridinyl)-2-piperidin-1-ylbenzamide |
| SMILES | CCn1cc(NC(=O)c2cc(S(=O)(=O)N(C)C)ccc2N2CCCCC2)ccc1=O |
| InChI | InChI=1S/C21H28N4O4S/c1-4-24-15-16(8-11-20(24)26)22-21(27)18-14-17(30(28,29)23(2)3)9-10-19(18)25-12-6-5-7-13-25/h8-11,14-15H,4-7,12-13H2,1-3H3,(H,22,27) |
| InChIKey | DHEMYJPAUCSYHY-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 91.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |