C22H30N4O5S — CID 55990599
5-(diethylsulfamoyl)-N-(1-ethyl-6-oxo-3-pyridinyl)-2-morpholin-4-ylbenzamide (PubChem CID 55990599) has the molecular formula C22H30N4O5S and a molecular weight of 462.57 g/mol. Its IUPAC name is 5-(diethylsulfamoyl)-N-(1-ethyl-6-oxo-3-pyridinyl)-2-morpholin-4-ylbenzamide.
| Compound Name | 5-(diethylsulfamoyl)-N-(1-ethyl-6-oxo-3-pyridinyl)-2-morpholin-4-ylbenzamide |
|---|---|
| PubChem CID | 55990599 |
| Molecular Formula | C22H30N4O5S |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | 5-(diethylsulfamoyl)-N-(1-ethyl-6-oxo-3-pyridinyl)-2-morpholin-4-ylbenzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(N2CCOCC2)c(C(=O)Nc2ccc(=O)n(CC)c2)c1 |
| InChI | InChI=1S/C22H30N4O5S/c1-4-24-16-17(7-10-21(24)27)23-22(28)19-15-18(32(29,30)26(5-2)6-3)8-9-20(19)25-11-13-31-14-12-25/h7-10,15-16H,4-6,11-14H2,1-3H3,(H,23,28) |
| InChIKey | RBGFSUADICRLJD-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 100.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |