C17H25N3O6S — CID 119223365
2-[[5-(dimethylsulfamoyl)-2-morpholin-4-ylbenzoyl]amino]butanoic acid (PubChem CID 119223365) has the molecular formula C17H25N3O6S and a molecular weight of 399.47 g/mol. Its IUPAC name is 2-[[5-(dimethylsulfamoyl)-2-morpholin-4-ylbenzoyl]amino]butanoic acid.
| Compound Name | 2-[[5-(dimethylsulfamoyl)-2-morpholin-4-ylbenzoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 119223365 |
| Molecular Formula | C17H25N3O6S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 2-[[5-(dimethylsulfamoyl)-2-morpholin-4-ylbenzoyl]amino]butanoic acid |
| SMILES | CCC(NC(=O)c1cc(S(=O)(=O)N(C)C)ccc1N1CCOCC1)C(=O)O |
| InChI | InChI=1S/C17H25N3O6S/c1-4-14(17(22)23)18-16(21)13-11-12(27(24,25)19(2)3)5-6-15(13)20-7-9-26-10-8-20/h5-6,11,14H,4,7-10H2,1-3H3,(H,18,21)(H,22,23) |
| InChIKey | MAHHLVOQHJMMPK-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |