C21H25F2N3O4S — CID 46588089
N-[1-(2,5-difluorophenyl)ethyl]-5-(dimethylsulfamoyl)-2-morpholin-4-ylbenzamide (PubChem CID 46588089) has the molecular formula C21H25F2N3O4S and a molecular weight of 453.51 g/mol. Its IUPAC name is N-[1-(2,5-difluorophenyl)ethyl]-5-(dimethylsulfamoyl)-2-morpholin-4-ylbenzamide.
| Compound Name | N-[1-(2,5-difluorophenyl)ethyl]-5-(dimethylsulfamoyl)-2-morpholin-4-ylbenzamide |
|---|---|
| PubChem CID | 46588089 |
| Molecular Formula | C21H25F2N3O4S |
| Molecular Weight | 453.51 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | N-[1-(2,5-difluorophenyl)ethyl]-5-(dimethylsulfamoyl)-2-morpholin-4-ylbenzamide |
| SMILES | CC(NC(=O)c1cc(S(=O)(=O)N(C)C)ccc1N1CCOCC1)c1cc(F)ccc1F |
| InChI | InChI=1S/C21H25F2N3O4S/c1-14(17-12-15(22)4-6-19(17)23)24-21(27)18-13-16(31(28,29)25(2)3)5-7-20(18)26-8-10-30-11-9-26/h4-7,12-14H,8-11H2,1-3H3,(H,24,27) |
| InChIKey | JEVUZHJPCNBQFN-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.51 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |