C19H21F2N3O3S — CID 24982823
N-(2,4-difluorophenyl)-5-(dimethylsulfamoyl)-2-pyrrolidin-1-ylbenzamide (PubChem CID 24982823) has the molecular formula C19H21F2N3O3S and a molecular weight of 409.46 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-5-(dimethylsulfamoyl)-2-pyrrolidin-1-ylbenzamide.
| Compound Name | N-(2,4-difluorophenyl)-5-(dimethylsulfamoyl)-2-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 24982823 |
| Molecular Formula | C19H21F2N3O3S |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | N-(2,4-difluorophenyl)-5-(dimethylsulfamoyl)-2-pyrrolidin-1-ylbenzamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(N2CCCC2)c(C(=O)Nc2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C19H21F2N3O3S/c1-23(2)28(26,27)14-6-8-18(24-9-3-4-10-24)15(12-14)19(25)22-17-7-5-13(20)11-16(17)21/h5-8,11-12H,3-4,9-10H2,1-2H3,(H,22,25) |
| InChIKey | HTJWIGNKFTYEFI-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |