C21H26FN3O3S — CID 31737983
5-(dimethylsulfamoyl)-N-[2-(3-fluorophenyl)ethyl]-2-pyrrolidin-1-ylbenzamide (PubChem CID 31737983) has the molecular formula C21H26FN3O3S and a molecular weight of 419.52 g/mol. Its IUPAC name is 5-(dimethylsulfamoyl)-N-[2-(3-fluorophenyl)ethyl]-2-pyrrolidin-1-ylbenzamide.
| Compound Name | 5-(dimethylsulfamoyl)-N-[2-(3-fluorophenyl)ethyl]-2-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 31737983 |
| Molecular Formula | C21H26FN3O3S |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | 5-(dimethylsulfamoyl)-N-[2-(3-fluorophenyl)ethyl]-2-pyrrolidin-1-ylbenzamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(N2CCCC2)c(C(=O)NCCc2cccc(F)c2)c1 |
| InChI | InChI=1S/C21H26FN3O3S/c1-24(2)29(27,28)18-8-9-20(25-12-3-4-13-25)19(15-18)21(26)23-11-10-16-6-5-7-17(22)14-16/h5-9,14-15H,3-4,10-13H2,1-2H3,(H,23,26) |
| InChIKey | FAIGERKNPNWVAL-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |