C23H31FN4O3S — CID 55908803
5-(dimethylsulfamoyl)-N-[3-(2-fluoro-N-methylanilino)propyl]-2-pyrrolidin-1-ylbenzamide (PubChem CID 55908803) has the molecular formula C23H31FN4O3S and a molecular weight of 462.59 g/mol. Its IUPAC name is 5-(dimethylsulfamoyl)-N-[3-(2-fluoro-N-methylanilino)propyl]-2-pyrrolidin-1-ylbenzamide.
| Compound Name | 5-(dimethylsulfamoyl)-N-[3-(2-fluoro-N-methylanilino)propyl]-2-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 55908803 |
| Molecular Formula | C23H31FN4O3S |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | 5-(dimethylsulfamoyl)-N-[3-(2-fluoro-N-methylanilino)propyl]-2-pyrrolidin-1-ylbenzamide |
| SMILES | CN(CCCNC(=O)c1cc(S(=O)(=O)N(C)C)ccc1N1CCCC1)c1ccccc1F |
| InChI | InChI=1S/C23H31FN4O3S/c1-26(2)32(30,31)18-11-12-21(28-15-6-7-16-28)19(17-18)23(29)25-13-8-14-27(3)22-10-5-4-9-20(22)24/h4-5,9-12,17H,6-8,13-16H2,1-3H3,(H,25,29) |
| InChIKey | GAFIIPOIVNUIME-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|