C21H25F2N3O3S — CID 55908423
4-fluoro-N-[3-(2-fluoro-N-methylanilino)propyl]-3-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 55908423) has the molecular formula C21H25F2N3O3S and a molecular weight of 437.51 g/mol. Its IUPAC name is 4-fluoro-N-[3-(2-fluoro-N-methylanilino)propyl]-3-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | 4-fluoro-N-[3-(2-fluoro-N-methylanilino)propyl]-3-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 55908423 |
| Molecular Formula | C21H25F2N3O3S |
| Molecular Weight | 437.51 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | 4-fluoro-N-[3-(2-fluoro-N-methylanilino)propyl]-3-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | CN(CCCNC(=O)c1ccc(F)c(S(=O)(=O)N2CCCC2)c1)c1ccccc1F |
| InChI | InChI=1S/C21H25F2N3O3S/c1-25(19-8-3-2-7-17(19)22)12-6-11-24-21(27)16-9-10-18(23)20(15-16)30(28,29)26-13-4-5-14-26/h2-3,7-10,15H,4-6,11-14H2,1H3,(H,24,27) |
| InChIKey | KJRALHNOYAAOEF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.51 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|