C17H21FN4O3S — CID 78858270
4-fluoro-N-(3-imidazol-1-ylpropyl)-3-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 78858270) has the molecular formula C17H21FN4O3S and a molecular weight of 380.45 g/mol. Its IUPAC name is 4-fluoro-N-(3-imidazol-1-ylpropyl)-3-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | 4-fluoro-N-(3-imidazol-1-ylpropyl)-3-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 78858270 |
| Molecular Formula | C17H21FN4O3S |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 4-fluoro-N-(3-imidazol-1-ylpropyl)-3-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | O=C(NCCCn1ccnc1)c1ccc(F)c(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C17H21FN4O3S/c18-15-5-4-14(12-16(15)26(24,25)22-9-1-2-10-22)17(23)20-6-3-8-21-11-7-19-13-21/h4-5,7,11-13H,1-3,6,8-10H2,(H,20,23) |
| InChIKey | PRVVJIBWWHYNNR-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|