C18H23ClN4O3S — CID 30944265
4-chloro-N-(3-imidazol-1-ylpropyl)-3-piperidin-1-ylsulfonylbenzamide (PubChem CID 30944265) has the molecular formula C18H23ClN4O3S and a molecular weight of 410.93 g/mol. Its IUPAC name is 4-chloro-N-(3-imidazol-1-ylpropyl)-3-piperidin-1-ylsulfonylbenzamide.
| Compound Name | 4-chloro-N-(3-imidazol-1-ylpropyl)-3-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 30944265 |
| Molecular Formula | C18H23ClN4O3S |
| Molecular Weight | 410.93 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | 4-chloro-N-(3-imidazol-1-ylpropyl)-3-piperidin-1-ylsulfonylbenzamide |
| SMILES | O=C(NCCCn1ccnc1)c1ccc(Cl)c(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C18H23ClN4O3S/c19-16-6-5-15(18(24)21-7-4-9-22-12-8-20-14-22)13-17(16)27(25,26)23-10-2-1-3-11-23/h5-6,8,12-14H,1-4,7,9-11H2,(H,21,24) |
| InChIKey | XKJYXTFJCGLVGK-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.93 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|