C21H24ClN5O4S — CID 55861983
4-chloro-N-[3-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-3-piperidin-1-ylsulfonylbenzamide (PubChem CID 55861983) has the molecular formula C21H24ClN5O4S and a molecular weight of 477.97 g/mol. Its IUPAC name is 4-chloro-N-[3-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-3-piperidin-1-ylsulfonylbenzamide.
| Compound Name | 4-chloro-N-[3-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-3-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 55861983 |
| Molecular Formula | C21H24ClN5O4S |
| Molecular Weight | 477.97 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | 4-chloro-N-[3-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-3-piperidin-1-ylsulfonylbenzamide |
| SMILES | O=C(NCCCn1nc2ccccn2c1=O)c1ccc(Cl)c(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C21H24ClN5O4S/c22-17-9-8-16(15-18(17)32(30,31)25-11-3-1-4-12-25)20(28)23-10-6-14-27-21(29)26-13-5-2-7-19(26)24-27/h2,5,7-9,13,15H,1,3-4,6,10-12,14H2,(H,23,28) |
| InChIKey | DXJZWHXGQPKSIR-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.97 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|