C20H24ClN3O3S — CID 27298071
4-chloro-N-[2-(N-methylanilino)ethyl]-3-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 27298071) has the molecular formula C20H24ClN3O3S and a molecular weight of 421.95 g/mol. Its IUPAC name is 4-chloro-N-[2-(N-methylanilino)ethyl]-3-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | 4-chloro-N-[2-(N-methylanilino)ethyl]-3-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 27298071 |
| Molecular Formula | C20H24ClN3O3S |
| Molecular Weight | 421.95 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | 4-chloro-N-[2-(N-methylanilino)ethyl]-3-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | CN(CCNC(=O)c1ccc(Cl)c(S(=O)(=O)N2CCCC2)c1)c1ccccc1 |
| InChI | InChI=1S/C20H24ClN3O3S/c1-23(17-7-3-2-4-8-17)14-11-22-20(25)16-9-10-18(21)19(15-16)28(26,27)24-12-5-6-13-24/h2-4,7-10,15H,5-6,11-14H2,1H3,(H,22,25) |
| InChIKey | YEPIBINCRJINIX-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.95 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |