C20H23ClN2O4S — CID 7378013
4-chloro-N-[(2S)-2-hydroxy-2-phenylethyl]-3-piperidin-1-ylsulfonylbenzamide (PubChem CID 7378013) has the molecular formula C20H23ClN2O4S and a molecular weight of 422.93 g/mol. Its IUPAC name is 4-chloro-N-[(2S)-2-hydroxy-2-phenylethyl]-3-piperidin-1-ylsulfonylbenzamide.
| Compound Name | 4-chloro-N-[(2S)-2-hydroxy-2-phenylethyl]-3-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 7378013 |
| Molecular Formula | C20H23ClN2O4S |
| Molecular Weight | 422.93 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | 4-chloro-N-[(2S)-2-hydroxy-2-phenylethyl]-3-piperidin-1-ylsulfonylbenzamide |
| SMILES | O=C(NC[C@@H](O)c1ccccc1)c1ccc(Cl)c(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C20H23ClN2O4S/c21-17-10-9-16(13-19(17)28(26,27)23-11-5-2-6-12-23)20(25)22-14-18(24)15-7-3-1-4-8-15/h1,3-4,7-10,13,18,24H,2,5-6,11-12,14H2,(H,22,25)/t18-/m1/s1 |
| InChIKey | CTDUASWMZFYBRO-GOSISDBHSA-N |
| XLogP | 2.98 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.93 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |