C18H20ClN3O3S — CID 78774797
4-chloro-N'-phenyl-3-piperidin-1-ylsulfonylbenzohydrazide (PubChem CID 78774797) has the molecular formula C18H20ClN3O3S and a molecular weight of 393.90 g/mol. Its IUPAC name is 4-chloro-N'-phenyl-3-piperidin-1-ylsulfonylbenzohydrazide.
| Compound Name | 4-chloro-N'-phenyl-3-piperidin-1-ylsulfonylbenzohydrazide |
|---|---|
| PubChem CID | 78774797 |
| Molecular Formula | C18H20ClN3O3S |
| Molecular Weight | 393.90 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | 4-chloro-N'-phenyl-3-piperidin-1-ylsulfonylbenzohydrazide |
| SMILES | O=C(NNc1ccccc1)c1ccc(Cl)c(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C18H20ClN3O3S/c19-16-10-9-14(18(23)21-20-15-7-3-1-4-8-15)13-17(16)26(24,25)22-11-5-2-6-12-22/h1,3-4,7-10,13,20H,2,5-6,11-12H2,(H,21,23) |
| InChIKey | MKJCGPGAFAWWLP-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.90 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|