C18H17ClFN3O4S — CID 2124994
4-chloro-N'-(2-fluorobenzoyl)-3-pyrrolidin-1-ylsulfonylbenzohydrazide (PubChem CID 2124994) has the molecular formula C18H17ClFN3O4S and a molecular weight of 425.87 g/mol. Its IUPAC name is 4-chloro-N'-(2-fluorobenzoyl)-3-pyrrolidin-1-ylsulfonylbenzohydrazide.
| Compound Name | 4-chloro-N'-(2-fluorobenzoyl)-3-pyrrolidin-1-ylsulfonylbenzohydrazide |
|---|---|
| PubChem CID | 2124994 |
| Molecular Formula | C18H17ClFN3O4S |
| Molecular Weight | 425.87 g/mol |
| Exact Mass | 425.06 |
| IUPAC Name | 4-chloro-N'-(2-fluorobenzoyl)-3-pyrrolidin-1-ylsulfonylbenzohydrazide |
| SMILES | O=C(NNC(=O)c1ccccc1F)c1ccc(Cl)c(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C18H17ClFN3O4S/c19-14-8-7-12(11-16(14)28(26,27)23-9-3-4-10-23)17(24)21-22-18(25)13-5-1-2-6-15(13)20/h1-2,5-8,11H,3-4,9-10H2,(H,21,24)(H,22,25) |
| InChIKey | PJPLKMIEBSDRND-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.87 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|