C20H22FN3O4S — CID 26863667
4-fluoro-N'-(2-phenylacetyl)-3-piperidin-1-ylsulfonylbenzohydrazide (PubChem CID 26863667) has the molecular formula C20H22FN3O4S and a molecular weight of 419.48 g/mol. Its IUPAC name is 4-fluoro-N'-(2-phenylacetyl)-3-piperidin-1-ylsulfonylbenzohydrazide.
| Compound Name | 4-fluoro-N'-(2-phenylacetyl)-3-piperidin-1-ylsulfonylbenzohydrazide |
|---|---|
| PubChem CID | 26863667 |
| Molecular Formula | C20H22FN3O4S |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | 4-fluoro-N'-(2-phenylacetyl)-3-piperidin-1-ylsulfonylbenzohydrazide |
| SMILES | O=C(Cc1ccccc1)NNC(=O)c1ccc(F)c(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C20H22FN3O4S/c21-17-10-9-16(14-18(17)29(27,28)24-11-5-2-6-12-24)20(26)23-22-19(25)13-15-7-3-1-4-8-15/h1,3-4,7-10,14H,2,5-6,11-13H2,(H,22,25)(H,23,26) |
| InChIKey | IHYVHROCVQQXCX-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|