C21H24ClN3O4S — CID 34572984
3-(azepan-1-ylsulfonyl)-N'-[2-(4-chlorophenyl)acetyl]benzohydrazide (PubChem CID 34572984) has the molecular formula C21H24ClN3O4S and a molecular weight of 449.96 g/mol. Its IUPAC name is 3-(azepan-1-ylsulfonyl)-N'-[2-(4-chlorophenyl)acetyl]benzohydrazide.
| Compound Name | 3-(azepan-1-ylsulfonyl)-N'-[2-(4-chlorophenyl)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 34572984 |
| Molecular Formula | C21H24ClN3O4S |
| Molecular Weight | 449.96 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | 3-(azepan-1-ylsulfonyl)-N'-[2-(4-chlorophenyl)acetyl]benzohydrazide |
| SMILES | O=C(Cc1ccc(Cl)cc1)NNC(=O)c1cccc(S(=O)(=O)N2CCCCCC2)c1 |
| InChI | InChI=1S/C21H24ClN3O4S/c22-18-10-8-16(9-11-18)14-20(26)23-24-21(27)17-6-5-7-19(15-17)30(28,29)25-12-3-1-2-4-13-25/h5-11,15H,1-4,12-14H2,(H,23,26)(H,24,27) |
| InChIKey | QDMPMKOVLHHMGV-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.96 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|