C20H23N3O5S — CID 9093828
N'-[2-(2-methoxyphenyl)acetyl]-3-pyrrolidin-1-ylsulfonylbenzohydrazide (PubChem CID 9093828) has the molecular formula C20H23N3O5S and a molecular weight of 417.49 g/mol. Its IUPAC name is N'-[2-(2-methoxyphenyl)acetyl]-3-pyrrolidin-1-ylsulfonylbenzohydrazide.
| Compound Name | N'-[2-(2-methoxyphenyl)acetyl]-3-pyrrolidin-1-ylsulfonylbenzohydrazide |
|---|---|
| PubChem CID | 9093828 |
| Molecular Formula | C20H23N3O5S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | N'-[2-(2-methoxyphenyl)acetyl]-3-pyrrolidin-1-ylsulfonylbenzohydrazide |
| SMILES | COc1ccccc1CC(=O)NNC(=O)c1cccc(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C20H23N3O5S/c1-28-18-10-3-2-7-15(18)14-19(24)21-22-20(25)16-8-6-9-17(13-16)29(26,27)23-11-4-5-12-23/h2-3,6-10,13H,4-5,11-12,14H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | KZRHYADUVISCSF-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|