C22H27N3O6S — CID 26621859
3-methoxy-4-propoxy-N'-(3-pyrrolidin-1-ylsulfonylbenzoyl)benzohydrazide (PubChem CID 26621859) has the molecular formula C22H27N3O6S and a molecular weight of 461.54 g/mol. Its IUPAC name is 3-methoxy-4-propoxy-N'-(3-pyrrolidin-1-ylsulfonylbenzoyl)benzohydrazide.
| Compound Name | 3-methoxy-4-propoxy-N'-(3-pyrrolidin-1-ylsulfonylbenzoyl)benzohydrazide |
|---|---|
| PubChem CID | 26621859 |
| Molecular Formula | C22H27N3O6S |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | 3-methoxy-4-propoxy-N'-(3-pyrrolidin-1-ylsulfonylbenzoyl)benzohydrazide |
| SMILES | CCCOc1ccc(C(=O)NNC(=O)c2cccc(S(=O)(=O)N3CCCC3)c2)cc1OC |
| InChI | InChI=1S/C22H27N3O6S/c1-3-13-31-19-10-9-17(15-20(19)30-2)22(27)24-23-21(26)16-7-6-8-18(14-16)32(28,29)25-11-4-5-12-25/h6-10,14-15H,3-5,11-13H2,1-2H3,(H,23,26)(H,24,27) |
| InChIKey | GCPGSGWHHFZVKN-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|