C20H23N3O6S — CID 30862218
2,5-dimethoxy-N'-(3-pyrrolidin-1-ylsulfonylbenzoyl)benzohydrazide (PubChem CID 30862218) has the molecular formula C20H23N3O6S and a molecular weight of 433.49 g/mol. Its IUPAC name is 2,5-dimethoxy-N'-(3-pyrrolidin-1-ylsulfonylbenzoyl)benzohydrazide.
| Compound Name | 2,5-dimethoxy-N'-(3-pyrrolidin-1-ylsulfonylbenzoyl)benzohydrazide |
|---|---|
| PubChem CID | 30862218 |
| Molecular Formula | C20H23N3O6S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | 2,5-dimethoxy-N'-(3-pyrrolidin-1-ylsulfonylbenzoyl)benzohydrazide |
| SMILES | COc1ccc(OC)c(C(=O)NNC(=O)c2cccc(S(=O)(=O)N3CCCC3)c2)c1 |
| InChI | InChI=1S/C20H23N3O6S/c1-28-15-8-9-18(29-2)17(13-15)20(25)22-21-19(24)14-6-5-7-16(12-14)30(26,27)23-10-3-4-11-23/h5-9,12-13H,3-4,10-11H2,1-2H3,(H,21,24)(H,22,25) |
| InChIKey | OOOQGBWCZUPRSO-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|