C19H21ClN2O4S — CID 60597425
N-(2-chloro-4-methoxyphenyl)-3-piperidin-1-ylsulfonylbenzamide (PubChem CID 60597425) has the molecular formula C19H21ClN2O4S and a molecular weight of 408.91 g/mol. Its IUPAC name is N-(2-chloro-4-methoxyphenyl)-3-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-(2-chloro-4-methoxyphenyl)-3-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 60597425 |
| Molecular Formula | C19H21ClN2O4S |
| Molecular Weight | 408.91 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | N-(2-chloro-4-methoxyphenyl)-3-piperidin-1-ylsulfonylbenzamide |
| SMILES | COc1ccc(NC(=O)c2cccc(S(=O)(=O)N3CCCCC3)c2)c(Cl)c1 |
| InChI | InChI=1S/C19H21ClN2O4S/c1-26-15-8-9-18(17(20)13-15)21-19(23)14-6-5-7-16(12-14)27(24,25)22-10-3-2-4-11-22/h5-9,12-13H,2-4,10-11H2,1H3,(H,21,23) |
| InChIKey | PTPRAEALZWIVKN-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.91 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |