C18H21N3O5S — CID 4782675
2,5-dimethyl-N'-(3-pyrrolidin-1-ylsulfonylbenzoyl)furan-3-carbohydrazide (PubChem CID 4782675) has the molecular formula C18H21N3O5S and a molecular weight of 391.45 g/mol. Its IUPAC name is 2,5-dimethyl-N'-(3-pyrrolidin-1-ylsulfonylbenzoyl)furan-3-carbohydrazide.
| Compound Name | 2,5-dimethyl-N'-(3-pyrrolidin-1-ylsulfonylbenzoyl)furan-3-carbohydrazide |
|---|---|
| PubChem CID | 4782675 |
| Molecular Formula | C18H21N3O5S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 2,5-dimethyl-N'-(3-pyrrolidin-1-ylsulfonylbenzoyl)furan-3-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNC(=O)c2cccc(S(=O)(=O)N3CCCC3)c2)c(C)o1 |
| InChI | InChI=1S/C18H21N3O5S/c1-12-10-16(13(2)26-12)18(23)20-19-17(22)14-6-5-7-15(11-14)27(24,25)21-8-3-4-9-21/h5-7,10-11H,3-4,8-9H2,1-2H3,(H,19,22)(H,20,23) |
| InChIKey | RLZWVYXIDHGBHL-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|