C13H18N4O3S2 — CID 8668824
1-methyl-3-[(3-pyrrolidin-1-ylsulfonylbenzoyl)amino]thiourea (PubChem CID 8668824) has the molecular formula C13H18N4O3S2 and a molecular weight of 342.45 g/mol. Its IUPAC name is 1-methyl-3-[(3-pyrrolidin-1-ylsulfonylbenzoyl)amino]thiourea.
| Compound Name | 1-methyl-3-[(3-pyrrolidin-1-ylsulfonylbenzoyl)amino]thiourea |
|---|---|
| PubChem CID | 8668824 |
| Molecular Formula | C13H18N4O3S2 |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 1-methyl-3-[(3-pyrrolidin-1-ylsulfonylbenzoyl)amino]thiourea |
| SMILES | CNC(=S)NNC(=O)c1cccc(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C13H18N4O3S2/c1-14-13(21)16-15-12(18)10-5-4-6-11(9-10)22(19,20)17-7-2-3-8-17/h4-6,9H,2-3,7-8H2,1H3,(H,15,18)(H2,14,16,21) |
| InChIKey | OFFHMXUNTWSSCQ-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|