C19H28N4O3S2 — CID 8668828
1-[(1R,2R)-2-methylcyclohexyl]-3-[(3-pyrrolidin-1-ylsulfonylbenzoyl)amino]thiourea (PubChem CID 8668828) has the molecular formula C19H28N4O3S2 and a molecular weight of 424.59 g/mol. Its IUPAC name is 1-[(1R,2R)-2-methylcyclohexyl]-3-[(3-pyrrolidin-1-ylsulfonylbenzoyl)amino]thiourea.
| Compound Name | 1-[(1R,2R)-2-methylcyclohexyl]-3-[(3-pyrrolidin-1-ylsulfonylbenzoyl)amino]thiourea |
|---|---|
| PubChem CID | 8668828 |
| Molecular Formula | C19H28N4O3S2 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | 1-[(1R,2R)-2-methylcyclohexyl]-3-[(3-pyrrolidin-1-ylsulfonylbenzoyl)amino]thiourea |
| SMILES | C[C@@H]1CCCC[C@H]1NC(=S)NNC(=O)c1cccc(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C19H28N4O3S2/c1-14-7-2-3-10-17(14)20-19(27)22-21-18(24)15-8-6-9-16(13-15)28(25,26)23-11-4-5-12-23/h6,8-9,13-14,17H,2-5,7,10-12H2,1H3,(H,21,24)(H2,20,22,27)/t14-,17-/m1/s1 |
| InChIKey | GOROUNXZRIRRRP-RHSMWYFYSA-N |
| XLogP | 2.16 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|