C19H28N2O3S — CID 9463751
N-[(1S,2R)-2-methylcyclohexyl]-4-piperidin-1-ylsulfonylbenzamide (PubChem CID 9463751) has the molecular formula C19H28N2O3S and a molecular weight of 364.51 g/mol. Its IUPAC name is N-[(1S,2R)-2-methylcyclohexyl]-4-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-[(1S,2R)-2-methylcyclohexyl]-4-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 9463751 |
| Molecular Formula | C19H28N2O3S |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | N-[(1S,2R)-2-methylcyclohexyl]-4-piperidin-1-ylsulfonylbenzamide |
| SMILES | C[C@@H]1CCCC[C@@H]1NC(=O)c1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C19H28N2O3S/c1-15-7-3-4-8-18(15)20-19(22)16-9-11-17(12-10-16)25(23,24)21-13-5-2-6-14-21/h9-12,15,18H,2-8,13-14H2,1H3,(H,20,22)/t15-,18+/m1/s1 |
| InChIKey | LRRMAUNEOPLPJL-QAPCUYQASA-N |
| XLogP | 3.17 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |