C20H24N2O3S — CID 7478902
N-[(1R,2R)-2-methylcyclohexyl]-4-(phenylsulfamoyl)benzamide (PubChem CID 7478902) has the molecular formula C20H24N2O3S and a molecular weight of 372.49 g/mol. Its IUPAC name is N-[(1R,2R)-2-methylcyclohexyl]-4-(phenylsulfamoyl)benzamide.
| Compound Name | N-[(1R,2R)-2-methylcyclohexyl]-4-(phenylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 7478902 |
| Molecular Formula | C20H24N2O3S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | N-[(1R,2R)-2-methylcyclohexyl]-4-(phenylsulfamoyl)benzamide |
| SMILES | C[C@@H]1CCCC[C@H]1NC(=O)c1ccc(S(=O)(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C20H24N2O3S/c1-15-7-5-6-10-19(15)21-20(23)16-11-13-18(14-12-16)26(24,25)22-17-8-3-2-4-9-17/h2-4,8-9,11-15,19,22H,5-7,10H2,1H3,(H,21,23)/t15-,19-/m1/s1 |
| InChIKey | HPUAIVNLGGTOOP-DNVCBOLYSA-N |
| XLogP | 3.80 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |