C19H20N2O5S — CID 120677340
cis-(1R,3S)-3-[[4-(phenylsulfamoyl)benzoyl]amino]cyclopentane-1-carboxylic acid (PubChem CID 120677340) has the molecular formula C19H20N2O5S and a molecular weight of 388.45 g/mol. Its IUPAC name is cis-(1R,3S)-3-[[4-(phenylsulfamoyl)benzoyl]amino]cyclopentane-1-carboxylic acid.
| Compound Name | cis-(1R,3S)-3-[[4-(phenylsulfamoyl)benzoyl]amino]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 120677340 |
| Molecular Formula | C19H20N2O5S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | cis-(1R,3S)-3-[[4-(phenylsulfamoyl)benzoyl]amino]cyclopentane-1-carboxylic acid |
| SMILES | O=C(N[C@H]1CC[C@@H](C(=O)O)C1)c1ccc(S(=O)(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C19H20N2O5S/c22-18(20-16-9-6-14(12-16)19(23)24)13-7-10-17(11-8-13)27(25,26)21-15-4-2-1-3-5-15/h1-5,7-8,10-11,14,16,21H,6,9,12H2,(H,20,22)(H,23,24)/t14-,16+/m1/s1 |
| InChIKey | KVWDZMVBZFBSTC-ZBFHGGJFSA-N |
| XLogP | 2.47 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |