C16H22N2O6S — CID 120678088
cis-(1R,3S)-3-[[4-(2-methoxyethylsulfamoyl)benzoyl]amino]cyclopentane-1-carboxylic acid (PubChem CID 120678088) has the molecular formula C16H22N2O6S and a molecular weight of 370.43 g/mol. Its IUPAC name is cis-(1R,3S)-3-[[4-(2-methoxyethylsulfamoyl)benzoyl]amino]cyclopentane-1-carboxylic acid.
| Compound Name | cis-(1R,3S)-3-[[4-(2-methoxyethylsulfamoyl)benzoyl]amino]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 120678088 |
| Molecular Formula | C16H22N2O6S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | cis-(1R,3S)-3-[[4-(2-methoxyethylsulfamoyl)benzoyl]amino]cyclopentane-1-carboxylic acid |
| SMILES | COCCNS(=O)(=O)c1ccc(C(=O)N[C@H]2CC[C@@H](C(=O)O)C2)cc1 |
| InChI | InChI=1S/C16H22N2O6S/c1-24-9-8-17-25(22,23)14-6-3-11(4-7-14)15(19)18-13-5-2-12(10-13)16(20)21/h3-4,6-7,12-13,17H,2,5,8-10H2,1H3,(H,18,19)(H,20,21)/t12-,13+/m1/s1 |
| InChIKey | MPJZFXBKEUEBRJ-OLZOCXBDSA-N |
| XLogP | 0.59 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|