C17H24N2O6S — CID 120677603
cis-(1R,3S)-3-[[5-(2-methoxyethylsulfamoyl)-2-methylbenzoyl]amino]cyclopentane-1-carboxylic acid (PubChem CID 120677603) has the molecular formula C17H24N2O6S and a molecular weight of 384.45 g/mol. Its IUPAC name is cis-(1R,3S)-3-[[5-(2-methoxyethylsulfamoyl)-2-methylbenzoyl]amino]cyclopentane-1-carboxylic acid.
| Compound Name | cis-(1R,3S)-3-[[5-(2-methoxyethylsulfamoyl)-2-methylbenzoyl]amino]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 120677603 |
| Molecular Formula | C17H24N2O6S |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | cis-(1R,3S)-3-[[5-(2-methoxyethylsulfamoyl)-2-methylbenzoyl]amino]cyclopentane-1-carboxylic acid |
| SMILES | COCCNS(=O)(=O)c1ccc(C)c(C(=O)N[C@H]2CC[C@@H](C(=O)O)C2)c1 |
| InChI | InChI=1S/C17H24N2O6S/c1-11-3-6-14(26(23,24)18-7-8-25-2)10-15(11)16(20)19-13-5-4-12(9-13)17(21)22/h3,6,10,12-13,18H,4-5,7-9H2,1-2H3,(H,19,20)(H,21,22)/t12-,13+/m1/s1 |
| InChIKey | NMXYNKVLIDXJSZ-OLZOCXBDSA-N |
| XLogP | 0.90 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|