C13H20N2O4S — CID 43002807
5-(2-methoxyethylsulfamoyl)-N,N,2-trimethylbenzamide (PubChem CID 43002807) has the molecular formula C13H20N2O4S and a molecular weight of 300.38 g/mol. Its IUPAC name is 5-(2-methoxyethylsulfamoyl)-N,N,2-trimethylbenzamide.
| Compound Name | 5-(2-methoxyethylsulfamoyl)-N,N,2-trimethylbenzamide |
|---|---|
| PubChem CID | 43002807 |
| Molecular Formula | C13H20N2O4S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 5-(2-methoxyethylsulfamoyl)-N,N,2-trimethylbenzamide |
| SMILES | COCCNS(=O)(=O)c1ccc(C)c(C(=O)N(C)C)c1 |
| InChI | InChI=1S/C13H20N2O4S/c1-10-5-6-11(9-12(10)13(16)15(2)3)20(17,18)14-7-8-19-4/h5-6,9,14H,7-8H2,1-4H3 |
| InChIKey | UMBQELXGTYRWFS-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|