About N-[(2,4-difluorophenyl)methyl]-5-(2-methoxyethylsulfamoyl)-N,2-dimethylbenzamide
N-[(2,4-difluorophenyl)methyl]-5-(2-methoxyethylsulfamoyl)-N,2-dimethylbenzamide (PubChem CID 43049204) has the molecular formula C19H22F2N2O4S
and a molecular weight of 412.46 g/mol. Its IUPAC name is N-[(2,4-difluorophenyl)methyl]-5-(2-methoxyethylsulfamoyl)-N,2-dimethylbenzamide.
Molecular Properties
| Compound Name | N-[(2,4-difluorophenyl)methyl]-5-(2-methoxyethylsulfamoyl)-N,2-dimethylbenzamide |
| PubChem CID | 43049204 |
| Molecular Formula | C19H22F2N2O4S |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | N-[(2,4-difluorophenyl)methyl]-5-(2-methoxyethylsulfamoyl)-N,2-dimethylbenzamide |
| SMILES | COCCNS(=O)(=O)c1ccc(C)c(C(=O)N(C)Cc2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C19H22F2N2O4S/c1-13-4-7-16(28(25,26)22-8-9-27-3)11-17(13)19(24)23(2)12-14-5-6-15(20)10-18(14)21/h4-7,10-11,22H,8-9,12H2,1-3H3 |
| InChIKey | DNHZXASEEXFZMG-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[(2,4-difluorophenyl)methyl]-5-(2-methoxyethylsulfamoyl)-N,2-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2,4-difluorophenyl)methyl]-5-(2-methoxyethylsulfamoyl)-N,2-dimethylbenzamide?
The IUPAC name of N-[(2,4-difluorophenyl)methyl]-5-(2-methoxyethylsulfamoyl)-N,2-dimethylbenzamide (CID 43049204) is N-[(2,4-difluorophenyl)methyl]-5-(2-methoxyethylsulfamoyl)-N,2-dimethylbenzamide.
What is the SMILES notation for N-[(2,4-difluorophenyl)methyl]-5-(2-methoxyethylsulfamoyl)-N,2-dimethylbenzamide?
The canonical SMILES for N-[(2,4-difluorophenyl)methyl]-5-(2-methoxyethylsulfamoyl)-N,2-dimethylbenzamide is COCCNS(=O)(=O)c1ccc(C)c(C(=O)N(C)Cc2ccc(F)cc2F)c1.
What is the InChIKey of N-[(2,4-difluorophenyl)methyl]-5-(2-methoxyethylsulfamoyl)-N,2-dimethylbenzamide?
The InChIKey is DNHZXASEEXFZMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22F2N2O4S/c1-13-4-7-16(28(25,26)22-8-9-27-3)11-17(13)19(24)23(2)12-14-5-6-15(20)10-18(14)21/h4-7,10-11,22H,8-9,12H2,1-3H3.
What are the key properties of N-[(2,4-difluorophenyl)methyl]-5-(2-methoxyethylsulfamoyl)-N,2-dimethylbenzamide?
N-[(2,4-difluorophenyl)methyl]-5-(2-methoxyethylsulfamoyl)-N,2-dimethylbenzamide has a molecular weight of 412.46 g/mol, XLogP of 2.47, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2,4-difluorophenyl)methyl]-5-(2-methoxyethylsulfamoyl)-N,2-dimethylbenzamide is sourced from PubChem (CID 43049204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).