C18H20BrFN2O4S — CID 55579772
N-[(5-bromo-2-fluorophenyl)methyl]-3-(2-methoxyethylsulfamoyl)-N-methylbenzamide (PubChem CID 55579772) has the molecular formula C18H20BrFN2O4S and a molecular weight of 459.34 g/mol. Its IUPAC name is N-[(5-bromo-2-fluorophenyl)methyl]-3-(2-methoxyethylsulfamoyl)-N-methylbenzamide.
| Compound Name | N-[(5-bromo-2-fluorophenyl)methyl]-3-(2-methoxyethylsulfamoyl)-N-methylbenzamide |
|---|---|
| PubChem CID | 55579772 |
| Molecular Formula | C18H20BrFN2O4S |
| Molecular Weight | 459.34 g/mol |
| Exact Mass | 458.03 |
| IUPAC Name | N-[(5-bromo-2-fluorophenyl)methyl]-3-(2-methoxyethylsulfamoyl)-N-methylbenzamide |
| SMILES | COCCNS(=O)(=O)c1cccc(C(=O)N(C)Cc2cc(Br)ccc2F)c1 |
| InChI | InChI=1S/C18H20BrFN2O4S/c1-22(12-14-10-15(19)6-7-17(14)20)18(23)13-4-3-5-16(11-13)27(24,25)21-8-9-26-2/h3-7,10-11,21H,8-9,12H2,1-2H3 |
| InChIKey | JFYJSBDBGJVCDZ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.34 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|