C17H29N3O4S — CID 119657426
N-(3-amino-4-methylpentyl)-3-(2-methoxyethylsulfamoyl)-N-methylbenzamide (PubChem CID 119657426) has the molecular formula C17H29N3O4S and a molecular weight of 371.50 g/mol. Its IUPAC name is N-(3-amino-4-methylpentyl)-3-(2-methoxyethylsulfamoyl)-N-methylbenzamide.
| Compound Name | N-(3-amino-4-methylpentyl)-3-(2-methoxyethylsulfamoyl)-N-methylbenzamide |
|---|---|
| PubChem CID | 119657426 |
| Molecular Formula | C17H29N3O4S |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | N-(3-amino-4-methylpentyl)-3-(2-methoxyethylsulfamoyl)-N-methylbenzamide |
| SMILES | COCCNS(=O)(=O)c1cccc(C(=O)N(C)CCC(N)C(C)C)c1 |
| InChI | InChI=1S/C17H29N3O4S/c1-13(2)16(18)8-10-20(3)17(21)14-6-5-7-15(12-14)25(22,23)19-9-11-24-4/h5-7,12-13,16,19H,8-11,18H2,1-4H3 |
| InChIKey | ANVFVDMSIJHWLM-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|