C14H22N2O5S — CID 55565589
3-(2-methoxyethylsulfamoyl)-N-(3-methoxypropyl)benzamide (PubChem CID 55565589) has the molecular formula C14H22N2O5S and a molecular weight of 330.41 g/mol. Its IUPAC name is 3-(2-methoxyethylsulfamoyl)-N-(3-methoxypropyl)benzamide.
| Compound Name | 3-(2-methoxyethylsulfamoyl)-N-(3-methoxypropyl)benzamide |
|---|---|
| PubChem CID | 55565589 |
| Molecular Formula | C14H22N2O5S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 3-(2-methoxyethylsulfamoyl)-N-(3-methoxypropyl)benzamide |
| SMILES | COCCCNC(=O)c1cccc(S(=O)(=O)NCCOC)c1 |
| InChI | InChI=1S/C14H22N2O5S/c1-20-9-4-7-15-14(17)12-5-3-6-13(11-12)22(18,19)16-8-10-21-2/h3,5-6,11,16H,4,7-10H2,1-2H3,(H,15,17) |
| InChIKey | ZLYWDCQULCFOBG-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|