C18H21FN2O5S — CID 35101237
N-[2-(3-fluorophenoxy)ethyl]-3-(2-methoxyethylsulfamoyl)benzamide (PubChem CID 35101237) has the molecular formula C18H21FN2O5S and a molecular weight of 396.44 g/mol. Its IUPAC name is N-[2-(3-fluorophenoxy)ethyl]-3-(2-methoxyethylsulfamoyl)benzamide.
| Compound Name | N-[2-(3-fluorophenoxy)ethyl]-3-(2-methoxyethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 35101237 |
| Molecular Formula | C18H21FN2O5S |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | N-[2-(3-fluorophenoxy)ethyl]-3-(2-methoxyethylsulfamoyl)benzamide |
| SMILES | COCCNS(=O)(=O)c1cccc(C(=O)NCCOc2cccc(F)c2)c1 |
| InChI | InChI=1S/C18H21FN2O5S/c1-25-10-9-21-27(23,24)17-7-2-4-14(12-17)18(22)20-8-11-26-16-6-3-5-15(19)13-16/h2-7,12-13,21H,8-11H2,1H3,(H,20,22) |
| InChIKey | QPJSXONMUITANM-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|