C24H22F2N2O4 — CID 166196673
1-N,4-N-bis[2-(3-fluorophenoxy)ethyl]benzene-1,4-dicarboxamide (PubChem CID 166196673) has the molecular formula C24H22F2N2O4 and a molecular weight of 440.45 g/mol. Its IUPAC name is 1-N,4-N-bis[2-(3-fluorophenoxy)ethyl]benzene-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis[2-(3-fluorophenoxy)ethyl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 166196673 |
| Molecular Formula | C24H22F2N2O4 |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | 1-N,4-N-bis[2-(3-fluorophenoxy)ethyl]benzene-1,4-dicarboxamide |
| SMILES | O=C(NCCOc1cccc(F)c1)c1ccc(C(=O)NCCOc2cccc(F)c2)cc1 |
| InChI | InChI=1S/C24H22F2N2O4/c25-19-3-1-5-21(15-19)31-13-11-27-23(29)17-7-9-18(10-8-17)24(30)28-12-14-32-22-6-2-4-20(26)16-22/h1-10,15-16H,11-14H2,(H,27,29)(H,28,30) |
| InChIKey | ZWRWLGILXODRDL-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|