C16H18FNO5S — CID 113099287
N-[2-(3-fluorophenoxy)ethyl]-3,4-dimethoxybenzenesulfonamide (PubChem CID 113099287) has the molecular formula C16H18FNO5S and a molecular weight of 355.39 g/mol. Its IUPAC name is N-[2-(3-fluorophenoxy)ethyl]-3,4-dimethoxybenzenesulfonamide.
| Compound Name | N-[2-(3-fluorophenoxy)ethyl]-3,4-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 113099287 |
| Molecular Formula | C16H18FNO5S |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | N-[2-(3-fluorophenoxy)ethyl]-3,4-dimethoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCCOc2cccc(F)c2)cc1OC |
| InChI | InChI=1S/C16H18FNO5S/c1-21-15-7-6-14(11-16(15)22-2)24(19,20)18-8-9-23-13-5-3-4-12(17)10-13/h3-7,10-11,18H,8-9H2,1-2H3 |
| InChIKey | IFFWEFKWMXUTQM-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|