C16H19NO6S2 — CID 34111480
N-[2-(3-methoxyphenoxy)ethyl]-3-methylsulfonylbenzenesulfonamide (PubChem CID 34111480) has the molecular formula C16H19NO6S2 and a molecular weight of 385.46 g/mol. Its IUPAC name is N-[2-(3-methoxyphenoxy)ethyl]-3-methylsulfonylbenzenesulfonamide.
| Compound Name | N-[2-(3-methoxyphenoxy)ethyl]-3-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 34111480 |
| Molecular Formula | C16H19NO6S2 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | N-[2-(3-methoxyphenoxy)ethyl]-3-methylsulfonylbenzenesulfonamide |
| SMILES | COc1cccc(OCCNS(=O)(=O)c2cccc(S(C)(=O)=O)c2)c1 |
| InChI | InChI=1S/C16H19NO6S2/c1-22-13-5-3-6-14(11-13)23-10-9-17-25(20,21)16-8-4-7-15(12-16)24(2,18)19/h3-8,11-12,17H,9-10H2,1-2H3 |
| InChIKey | MPNOOJUWXQPBOR-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|