C19H24N2O6S2 — CID 55598696
N-[2-(3-methoxyphenoxy)ethyl]-4-pyrrolidin-1-ylsulfonylbenzenesulfonamide (PubChem CID 55598696) has the molecular formula C19H24N2O6S2 and a molecular weight of 440.54 g/mol. Its IUPAC name is N-[2-(3-methoxyphenoxy)ethyl]-4-pyrrolidin-1-ylsulfonylbenzenesulfonamide.
| Compound Name | N-[2-(3-methoxyphenoxy)ethyl]-4-pyrrolidin-1-ylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 55598696 |
| Molecular Formula | C19H24N2O6S2 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | N-[2-(3-methoxyphenoxy)ethyl]-4-pyrrolidin-1-ylsulfonylbenzenesulfonamide |
| SMILES | COc1cccc(OCCNS(=O)(=O)c2ccc(S(=O)(=O)N3CCCC3)cc2)c1 |
| InChI | InChI=1S/C19H24N2O6S2/c1-26-16-5-4-6-17(15-16)27-14-11-20-28(22,23)18-7-9-19(10-8-18)29(24,25)21-12-2-3-13-21/h4-10,15,20H,2-3,11-14H2,1H3 |
| InChIKey | XJNHCKBEPDVJLZ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|