C21H26N2O7S — CID 55586581
2-methoxy-N-[2-(3-methoxyphenoxy)ethyl]-5-morpholin-4-ylsulfonylbenzamide (PubChem CID 55586581) has the molecular formula C21H26N2O7S and a molecular weight of 450.51 g/mol. Its IUPAC name is 2-methoxy-N-[2-(3-methoxyphenoxy)ethyl]-5-morpholin-4-ylsulfonylbenzamide.
| Compound Name | 2-methoxy-N-[2-(3-methoxyphenoxy)ethyl]-5-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 55586581 |
| Molecular Formula | C21H26N2O7S |
| Molecular Weight | 450.51 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 2-methoxy-N-[2-(3-methoxyphenoxy)ethyl]-5-morpholin-4-ylsulfonylbenzamide |
| SMILES | COc1cccc(OCCNC(=O)c2cc(S(=O)(=O)N3CCOCC3)ccc2OC)c1 |
| InChI | InChI=1S/C21H26N2O7S/c1-27-16-4-3-5-17(14-16)30-11-8-22-21(24)19-15-18(6-7-20(19)28-2)31(25,26)23-9-12-29-13-10-23/h3-7,14-15H,8-13H2,1-2H3,(H,22,24) |
| InChIKey | GBUOUCUOWKVLKT-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.51 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|