C19H30N2O5S — CID 28591079
N-(2,4-dimethylpentan-3-yl)-2-methoxy-5-morpholin-4-ylsulfonylbenzamide (PubChem CID 28591079) has the molecular formula C19H30N2O5S and a molecular weight of 398.53 g/mol. Its IUPAC name is N-(2,4-dimethylpentan-3-yl)-2-methoxy-5-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-(2,4-dimethylpentan-3-yl)-2-methoxy-5-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 28591079 |
| Molecular Formula | C19H30N2O5S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | N-(2,4-dimethylpentan-3-yl)-2-methoxy-5-morpholin-4-ylsulfonylbenzamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCOCC2)cc1C(=O)NC(C(C)C)C(C)C |
| InChI | InChI=1S/C19H30N2O5S/c1-13(2)18(14(3)4)20-19(22)16-12-15(6-7-17(16)25-5)27(23,24)21-8-10-26-11-9-21/h6-7,12-14,18H,8-11H2,1-5H3,(H,20,22) |
| InChIKey | SOQRYUQWUJOUFL-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |