C20H22Cl2N2O5S — CID 46820089
N-[1-(2,4-dichlorophenyl)ethyl]-2-methoxy-5-morpholin-4-ylsulfonylbenzamide (PubChem CID 46820089) has the molecular formula C20H22Cl2N2O5S and a molecular weight of 473.38 g/mol. Its IUPAC name is N-[1-(2,4-dichlorophenyl)ethyl]-2-methoxy-5-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-[1-(2,4-dichlorophenyl)ethyl]-2-methoxy-5-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 46820089 |
| Molecular Formula | C20H22Cl2N2O5S |
| Molecular Weight | 473.38 g/mol |
| Exact Mass | 472.06 |
| IUPAC Name | N-[1-(2,4-dichlorophenyl)ethyl]-2-methoxy-5-morpholin-4-ylsulfonylbenzamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCOCC2)cc1C(=O)NC(C)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H22Cl2N2O5S/c1-13(16-5-3-14(21)11-18(16)22)23-20(25)17-12-15(4-6-19(17)28-2)30(26,27)24-7-9-29-10-8-24/h3-6,11-13H,7-10H2,1-2H3,(H,23,25) |
| InChIKey | HVPXHPZYGIZCQQ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.38 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |