C18H19ClN2O5S — CID 18195774
N-(2-chlorophenyl)-2-methoxy-5-morpholin-4-ylsulfonylbenzamide (PubChem CID 18195774) has the molecular formula C18H19ClN2O5S and a molecular weight of 410.88 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-methoxy-5-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-(2-chlorophenyl)-2-methoxy-5-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 18195774 |
| Molecular Formula | C18H19ClN2O5S |
| Molecular Weight | 410.88 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | N-(2-chlorophenyl)-2-methoxy-5-morpholin-4-ylsulfonylbenzamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCOCC2)cc1C(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C18H19ClN2O5S/c1-25-17-7-6-13(27(23,24)21-8-10-26-11-9-21)12-14(17)18(22)20-16-5-3-2-4-15(16)19/h2-7,12H,8-11H2,1H3,(H,20,22) |
| InChIKey | BZUONYRATUKLOK-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.88 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |