C19H21ClN2O6S — CID 26364799
2-chloro-N-(3,4-dimethoxyphenyl)-5-morpholin-4-ylsulfonylbenzamide (PubChem CID 26364799) has the molecular formula C19H21ClN2O6S and a molecular weight of 440.91 g/mol. Its IUPAC name is 2-chloro-N-(3,4-dimethoxyphenyl)-5-morpholin-4-ylsulfonylbenzamide.
| Compound Name | 2-chloro-N-(3,4-dimethoxyphenyl)-5-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 26364799 |
| Molecular Formula | C19H21ClN2O6S |
| Molecular Weight | 440.91 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | 2-chloro-N-(3,4-dimethoxyphenyl)-5-morpholin-4-ylsulfonylbenzamide |
| SMILES | COc1ccc(NC(=O)c2cc(S(=O)(=O)N3CCOCC3)ccc2Cl)cc1OC |
| InChI | InChI=1S/C19H21ClN2O6S/c1-26-17-6-3-13(11-18(17)27-2)21-19(23)15-12-14(4-5-16(15)20)29(24,25)22-7-9-28-10-8-22/h3-6,11-12H,7-10H2,1-2H3,(H,21,23) |
| InChIKey | QRKPVPYMKACGJB-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.91 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |