C22H30N2O5S2 — CID 55903780
N-(2-ethyl-1-thiophen-2-ylbutyl)-2-methoxy-5-morpholin-4-ylsulfonylbenzamide (PubChem CID 55903780) has the molecular formula C22H30N2O5S2 and a molecular weight of 466.63 g/mol. Its IUPAC name is N-(2-ethyl-1-thiophen-2-ylbutyl)-2-methoxy-5-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-(2-ethyl-1-thiophen-2-ylbutyl)-2-methoxy-5-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 55903780 |
| Molecular Formula | C22H30N2O5S2 |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | N-(2-ethyl-1-thiophen-2-ylbutyl)-2-methoxy-5-morpholin-4-ylsulfonylbenzamide |
| SMILES | CCC(CC)C(NC(=O)c1cc(S(=O)(=O)N2CCOCC2)ccc1OC)c1cccs1 |
| InChI | InChI=1S/C22H30N2O5S2/c1-4-16(5-2)21(20-7-6-14-30-20)23-22(25)18-15-17(8-9-19(18)28-3)31(26,27)24-10-12-29-13-11-24/h6-9,14-16,21H,4-5,10-13H2,1-3H3,(H,23,25) |
| InChIKey | NUBDLRFWSZTZJT-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |