C24H33N3O4S2 — CID 55336369
5-(azepan-1-ylsulfonyl)-2-methoxy-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)benzamide (PubChem CID 55336369) has the molecular formula C24H33N3O4S2 and a molecular weight of 491.68 g/mol. Its IUPAC name is 5-(azepan-1-ylsulfonyl)-2-methoxy-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)benzamide.
| Compound Name | 5-(azepan-1-ylsulfonyl)-2-methoxy-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)benzamide |
|---|---|
| PubChem CID | 55336369 |
| Molecular Formula | C24H33N3O4S2 |
| Molecular Weight | 491.68 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | 5-(azepan-1-ylsulfonyl)-2-methoxy-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)benzamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCCCCC2)cc1C(=O)NCC(c1cccs1)N1CCCC1 |
| InChI | InChI=1S/C24H33N3O4S2/c1-31-22-11-10-19(33(29,30)27-14-4-2-3-5-15-27)17-20(22)24(28)25-18-21(23-9-8-16-32-23)26-12-6-7-13-26/h8-11,16-17,21H,2-7,12-15,18H2,1H3,(H,25,28) |
| InChIKey | XRKSGAIERFQPNI-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.68 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |